О находках минералов группы фужерита в пресноводных озерах Ильменского заповедника (Южный Урал)

Тип работы:

Узнать стоимость новой

Детальная информация о работе

Выдержка из работы

УДК 549(234. 853)
П. М. Вализер1, Е. П. Щербакова2, Н. К. Никандрова2, А. С. Никандров1, С. Н. Никандров1
1Ильменский гос. заповедник УрО РАН, Миасс- nik@ilmeny. ac. ru 2Институт минералогии УрО РАН, Миасс- sherbakova@mineralogy. ru
Кратко охарактеризованы минералы группы фужерита Fe2+6(1_x)Fe3+6xO12H2(7_3X)CO3x3H2O, обнаруженные в донных отложениях озер Таткуль и Большое Миассово Ильменского заповедника (Южный Урал). Описаны условия их местонахождения и диагностические свойства. Показано, что наряду с мёссбауэритом и требёрденитом в донных отложениях оз. Таткуль присутствует еще одна Fe^-фаза, близкая по составу к бескарбонатному гидроксид-фужериту или синтетическому соединению Fe2+6(OH)10(H2O)2CO3x3H2O.
Ключевые слова: минералы группы фужерита, мёссбауэрит, требёрденит, мёссбауэровская спектроскопия, донные отложения, озерные мергели, озеро Таткуль, Ильменский заповедник.
P. M. Valizer1, E. P. Shcherbakova2, N. K. Nikandrova2, A. S. Nikandrov1, S. N. Nikandrov1
1Ilmensky State Reserve, UB Rus. Acad. Sci., Miass 2Institute of Mineralogy, UB Rus. Acad. Sci., Miass
Fougerite group minerals Fe^M^Fe^^O^H^y^CO^^O from the bottom sediments of the freshwater lakes Tatkul'- and Bol'-shoe Miassovo of the Ilmensky Reserve (South Urals) are shortly characterized. Their localization and diagnostic properties are described. It is shown that a Fe2+ phase closed to uncarbonate hydroxide-fuogerite or to synthetic compound Fe2+6(OH)10(H2O)2cO3x3H2O is presenttd in the lacustrine marls of the Lake Tatkul together with mossbauerite and trebeurdenite.
Key words: fougerite group minerals, mussbauer'-ite, treuberdenite, mossbauer spectroscopy, bottom sedimients, lacustrine marls, Lake Tatkul, Ilmensky Reserve.
В 2003 году Комиссией по новым минералам и названиям минералов Международной минералогической ассоциации был утвержден новый минеральный вид — фужерит Fe2+4Fe3+2(OH)12CO3x3H2O [7, 10]. Этот минерал, установленный в гле-евых почвах Франции, издавна был известен специалистам-химикам как основной компонент зеленой ржавчины (green rust), образующейся при коррозии железа и его сплавов в условиях дефицита кислорода [3]. В последующие годы были обнаружены еще два минерала: требёрденит Fe2+2Fe3+4O2(OH)10CO3x3H2O и мёссбауэрит Fe3+6O4(OH)8CO3x3H2O, отличающиеся от фужерита соотношениями Fe3+/Fe2+ и O/OH, а также синтезирована фаза Fe2+6(OH)10(H2O)2CO3x3H2O [8]. Это позволило выделить из семейства ги-дроталькита, объединяющего свыше пятидесяти слоевых двойных гидрок-сидов с дополнительными аниона-
ми, самостоятельную группу фужерита, члены которой кристаллизуются в тригональной сингонии (Я т) и имеют общую формулу Ре2+6(1-х) Ре3+6×012Н2(7_зх)С03хН20 [9].
В 2012—2013 гг. минералы группы фужерита были найдены в донных отложениях озер Таткуль и Большое Миассово, расположенных на территории Ильменского государственного заповедника (рис. 1). Озера различны по форме, размерам и глубине, однако сходны по гидрохимическим параметрам: пресноводные, с общей минерализацией 160−240 мг/л- воды относятся к гидрокарбонатному классу смешанного катионного состава при незначительном преобладании кальция [6]. Суммарная площадь водосбора озер превышает 200 км² и сложена различными метаморфическими и магматическими породами — от гранитов и миаскитов до ультрабазитов и мраморов [1, 6].
Мощность озерных донных отложений непостоянна и даже в различных секторах одного и того же озера варьирует от 2−3 до 10−20 м. Донные отложения характеризуются грубо двухчленным строением, в общем типичным для пресноводных озер Южного Урала: сверху развиты сапропели — рыхлые темные осадки с переменным содержанием органической и неорганической составляющих- нижние горизонты представлены плотными глинисто-карбонатными отложениями, или так называемыми озерными мергелями [2, 5, 6].
Озерные мергели в свежем виде имеют «холодный» голубовато-серый (стальной) цвет и визуально однородны. С течением времени они частично обезвоживаются и, теряя голубоватый оттенок, становятся более светлыми, зеленовато-сероватыми или желтовато-зеленоватыми.
Условия залегания и характерный цвет озерных мергелей позволи-
ли предположить, что они могут содержать минералы группы фужерита. Озерные мергели из донных отложений озера Таткуль были исследованы методами мёссбауэровской спектроскопии и рентгеновской дифракто-метрии, поскольку именно такое сочетание дает возможность не только обнаружить наличие каких-либо представителей данной группы, но и диагностировать их с точностью до минерального вида [4, 7, 8]. Полученные результаты кратко излагаются ниже, а также суммированы в таблице.
По данным рентгеновской диф-рактометрии, основными минералами озерных мергелей являются ил-лит, каолинит, кварц, полевые шпаты, кальцит — типичные для донных отложений пресноводных озер Урала [5]. Наряду с ключевыми линиями этих минералов на дифрактограммах озерных мергелей отмечаются слабые отражения, которые принято относить к характеристическим для членов группы фужерита. Они локализуются в области 7. 32−7. 37 А и осложняют конфигурацию каолинитового отражения, проявляясь на его правой стороне в виде пиков второго рода, или плеча (рис. 2). Величины межплоскостных расстояний для характеристического отражения 003 минералов группы фужерита зависят от соотношений Fe3+/Fe2+ и 0/0Н: при изменении Fe3+/Fe2+ от 1 до 0. 33, что соответствует переходу от мёссбауэри-та к собственно фужериту, они изменяются от 7. 30−7. 34 А до 7. 57−7. 63 А [7−10]. Кроме того, на дифрактог-раммах озерных мергелей присутствует небольшой, но хорошо выражен-
62'- Рис. 1. Схематическая карта района озер 58° Таткуль и Большое Миассово (Южный Урал) с указанием мест обнаружения фужеритов
(Лоз. Таткуль
ный пик 7. 95 А, который не относится ни к вышеотмеченно-му набору типичных минералов донных отложений, ни к членам группы фужерита. На диф-рактограммах вышележащих са-пропелей этот пик, так же как и пик 003 фужеритов, отсутствует.
Мессбауэровские спектры озерных мергелей в общем однотипны и характеризуются не-колькими хорошо разрешенными областями поглощения с различной степенью асимметричности, которые могут быть аппроксимированы четырьмя квадрупольными дублетами: одна пара дублетов может быть отнесена к Fe2+, а другая — к Fe3+. Во всех пробах преобладает Fe3+: еоотноше-ние Fe3+/Fe2+ изменяется в пределах 0. 66−0. 77 (рис. 3).
Для интерпретации мессбау-эровских спектров природных фу-жеритсодержащих образований была разработана модель, в основу ко-
торой положены данные о синтети Диагностические свойства минералов группы фужерита
ческих аналогах минералов группы фужерита [8]. Согласно этой модели, в том или ином конкретном объекте в зависимости от соотношения Fe3+/Fe2+ возможно существование только одной пары из трёх: Fe2+6(OH)10(H2O)2CO3x3H2O + фу-жерит, фужерит + требёрденит, тре-бёрденит + мёссбауэрит, которые находятся в топотактических сраста-
Параметры мёссбауэровских спектров
№ X Fe2+ Fe3+ d, А
5 Д % 5 Д % 5 Д % 5 Д %
1 0. 33 1. 25 2. 92 50 1. 25 2. 63 17 0. 48 0. 47 33 — - - 7. 63
2 0. 50 1. 21 2. 98 38 1. 21 2. 72 12 0. 49 0. 40 33 0. 49 0. 70 17 7. 57
3 0. 63 1. 24 2. 80 28 1. 24 3. 05 9 0. 48 0. 49 32 0. 48 0. 90 31 7. 56
4 0. 78 1. 21 2. 89 22 — - - 0. 47 0. 45 35 0. 47 0. 95 43
5 1. 00 — - - - - - 0. 47 0. 60 33 0. 47 0. 88 67 7. 34
6 0. 50 1. 27 2. 86 1. 25 2. 48 0. 46 0. 48 0. 46 0. 97 7. 92
7 0. 72 1. 245 2. 842 28 — - - 0. 429 0. 560 56 0. 44 1. 05 16
8 0. 74 1. 263 2. 908 26 — - - 0. 471 0. 381 52 0. 47 0. 98 22
9 0. 75 1. 551 2. 66 25 — - - 0. 558 0. 549 50 0. 564 0. 97 25
10 0. 77 1. 292 2. 877 23 — - - 0. 466 0. 405 46 0. 43 1. 07 31 7. 45
11 0. 67 1. 409 2. 52 19 1. 31 2. 14 14 0. 59 0. 51 38 0. 55 0. 96 29 7. 95, 7. 35
12 0. 69 1. 46 2. 38 21 1. 30 2. 06 10 0. 58 0. 53 22 0. 53 0. 90 47 7. 95, 7. 35
13 0. 77 1. 537 2. 32 16 1. 29 2. 14 7 0. 554 0. 550 45 0. 57 0. 99 32
Примечание. 1−5 — еинтетические аналоги минералов группы фужерита с различными соотношениями Fe3+/Fe2+ [8, 9]- 6−10 — глеевые почвы [7−10]- 11−13 — озерные мергели. Параметры мессбауэровских спектров: 5 — изомерный сдвиг, мм/е- А — квадрупольное расщепление, мм/е- % - относительное содержание компоненты- х — Fe3+/Fe2+ - ё, А — ключевые линии рентгенограммы- пустая графа — нет данных.
Рис. 2. Дифрактограмма озерных мергелей из озера Таткуль (проба ТАТ). Условия съемки: дифрактометр ДРОН-2. 0, FeKa-излучение, интервал съемки 26 10−38 A. Ca — кальцит, Fs — полевые шпаты, II — иллит, K — каолинит, Q — кварц. F — характеристический пик минералов группы фужерита,? — неидентифицированный пик
Рис. 3. Мессбауэровский спектр озерных мергелей из озера Таткуль (проба ТАТ).
Объяснения в тексте
ниях [8, 9]. Каждый дублет на мёс-сбауэровском спектре какого-либо образца, содержащего минералы группы фужерита, рассматривается, таким образом, в виде суперпозиции соответствующих дублетов, принадлежащих членам одной из трех эталонных пар. Так, для фужеритсодер-жащих глеевых почв из приморских болот Западной Франции соотношение Ре3+/Ре2+ составляет 0. 72−0. 77- их спектры аппроксимируются тремя дублетами, один из которых относится к двухвалентному, а два других — к трехвалентному железу. В соответствии с заданной моделью подобные спектры будут трактоваться как суперпозиция спектров эталонной пары требёрденит + мёссбауэрит [8, 9].
Соотношения Ре3+/Ре2+ в озерных мергелях Таткуля практически аналогичны таковым во французских
глеевых почвах, а их мёссбауэровские спектры близки по своему рисунку, хотя и аппроксимируются различным числом дублетов. Спектры, накопленные при одинаковых температурах, хорошо сопоставимы также по значениям мёссбауэровских параметров для общих дублетов, один из которых принадлежит двухвалентному, а два других — трёхвалентному железу (см. таблицу, № 9 и 13). Появление второго Ре2±дублета на спектрах озерных мергелей с позиций вышеописанной модели не объяснимо.
Полученные нами данные позволяют сделать вывод, что озерные мергели содержат два минерала группы фужерита — требёрденит и мёссбау-эрит. Наряду с ними в озерных мергелях Таткуля присутствует еще одна Ре2±фаза, близкая по своим характеристикам к бескарбонатному гидрок-
сид-фужериту или к синтетическому Fe2+6(OH)10 (H2O)2CO3x3H2O [7, 8]. Не следует исключать и вариант принципиально иной модели, подразумевающей существование в донных осадках оз. Таткуль других железосодержащих фаз.
Работа выполнена в рамках междисциплинарного проекта УрО РАН № 12-М-45−2051.
1. Вализер П. М., Щербакова Е. П., Мороз Т. Н, Никандров А. С., Никандров С. Н. О находках железо-марганцевых конкреций в пресноводных озерах Ильменского заповедника (Южный Урал) // Вестник Института геологии Коми Н Ц. Сыктывкар, 2012. № 12. C. 1719. 2. Дерягин В. В., Масленникова А. В., Дерягин А. В. Режимы осадконакопления в озерах Серебры и Сырыткуль (Южный Урал) // Вестник ЧелГУ, 2011. № 5. C. 2430. 3. Лавриненко Е. Н Fe (II)-Fe (III)-слоевые двойные гидроксиды (green rust) // Наноструктурное материаловедение, 2009. № 4. C. 16−53. 4. Никандрова Н. К., Никандров А. С., Щербакова Е. П., Никандров С. Н. Применение мессба-уэровской спектроскопии к исследованию железо -марганце вых конкреций из озера Большое Миассово // Минералы: строение, свойства, методы исследования. Екатеринбург: УрО РАН, 2012. С. 197−198. 5. Шляпников Д. С., Демчук Н. Г., Окунев П. В. Минеральные компоненты донных отложений озёр Урала. Свердловск: Изд-во УрГУ, 1990. 104 с. 6. Экология озера Большое Миассово. Миасс: ИГЗ УрО РАН, 2000. 318 с. 7. Bourrie G., Trolard F. Identification criteria for fougerite and nature of the interlayered anion // 19th World Congress of Soil Science, Brisbaine, Australia, 2010. P. 78−81. 8. Genin J-M. R, Guerin O., Herbillon A. J., Kuzman E., Mills S. J., Morin G., Ona-Nguema G., Ruby C., Upadhyay C. Redox topotactic reactions in FeII-III (oxy)-hydroxycarbonate new minerals related to fougerite in gleysoils- «trebeur-denite» and «mossbauerite» // Hyperfine interactions, 2012. V. 204. P. 71−81. 9. Mills S. J., Christy A. G., Genin J. M., Kameda T., Colombo F. Nomenclature of the hydrotalcite supergroup: natural layered double hydroxides // Min. Mag., 2012. V. 76 (5). P. 12 891 336. 10. TrolardF., Bourrie G., Abdelmoula M., Refait P., Feder F. Fougerite, a new mineral of the pyroaurite-iowaite group, description and crystal structure // Clay and Clay minerals, 2007. V. 55. P. 323−324.
Рецензент к. г. -м. н. И. В. Козырева

Заполнить форму текущей работой